C26H28FN5O — CID 139325338
6-[4-[3-(dimethylamino)propoxy]-3-fluorophenyl]-2-N-(quinolin-6-ylmethyl)pyridine-2,3-diamine (PubChem CID 139325338) has the molecular formula C26H28FN5O and a molecular weight of 445.54 g/mol. Its IUPAC name is 6-[4-[3-(dimethylamino)propoxy]-3-fluorophenyl]-2-N-(quinolin-6-ylmethyl)pyridine-2,3-diamine.
| Compound Name | 6-[4-[3-(dimethylamino)propoxy]-3-fluorophenyl]-2-N-(quinolin-6-ylmethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 139325338 |
| Molecular Formula | C26H28FN5O |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 6-[4-[3-(dimethylamino)propoxy]-3-fluorophenyl]-2-N-(quinolin-6-ylmethyl)pyridine-2,3-diamine |
| SMILES | CN(C)CCCOc1ccc(-c2ccc(N)c(NCc3ccc4ncccc4c3)n2)cc1F |
| InChI | InChI=1S/C26H28FN5O/c1-32(2)13-4-14-33-25-11-7-20(16-21(25)27)24-10-8-22(28)26(31-24)30-17-18-6-9-23-19(15-18)5-3-12-29-23/h3,5-12,15-16H,4,13-14,17,28H2,1-2H3,(H,30,31) |
| InChIKey | JKKGZFQVKYXXKM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|