C24H12N2O3 — CID 153304589
12-nitro-26-oxa-14-azaheptacyclo[12.10.1.13,24.02,7.08,13.015,20.021,25]hexacosa-1(24),2(7),3,5,8(13),9,11,15,17,19,21(25),22-dodecaene (PubChem CID 153304589) has the molecular formula C24H12N2O3 and a molecular weight of 376.37 g/mol. Its IUPAC name is 12-nitro-26-oxa-14-azaheptacyclo[12.10.1.13,24.02,7.08,13.015,20.021,25]hexacosa-1(24),2(7),3,5,8(13),9,11,15,17,19,21(25),22-dodecaene.
| Compound Name | 12-nitro-26-oxa-14-azaheptacyclo[12.10.1.13,24.02,7.08,13.015,20.021,25]hexacosa-1(24),2(7),3,5,8(13),9,11,15,17,19,21(25),22-dodecaene |
|---|---|
| PubChem CID | 153304589 |
| Molecular Formula | C24H12N2O3 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 12-nitro-26-oxa-14-azaheptacyclo[12.10.1.13,24.02,7.08,13.015,20.021,25]hexacosa-1(24),2(7),3,5,8(13),9,11,15,17,19,21(25),22-dodecaene |
| SMILES | O=[N+]([O-])c1cccc2c3cccc4oc5ccc6c7ccccc7n(c12)c6c5c43 |
| InChI | InChI=1S/C24H12N2O3/c27-26(28)18-9-3-7-15-14-6-4-10-19-21(14)22-20(29-19)12-11-16-13-5-1-2-8-17(13)25(23(15)18)24(16)22/h1-12H |
| InChIKey | JDYCAYNDHWSKDU-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 60.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|