C12H15N5O3 — CID 83018232
N-(4-methylpiperazin-1-yl)-4-nitro-1,3-benzoxazol-2-amine (PubChem CID 83018232) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is N-(4-methylpiperazin-1-yl)-4-nitro-1,3-benzoxazol-2-amine.
| Compound Name | N-(4-methylpiperazin-1-yl)-4-nitro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 83018232 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-(4-methylpiperazin-1-yl)-4-nitro-1,3-benzoxazol-2-amine |
| SMILES | CN1CCN(Nc2nc3c([N+](=O)[O-])cccc3o2)CC1 |
| InChI | InChI=1S/C12H15N5O3/c1-15-5-7-16(8-6-15)14-12-13-11-9(17(18)19)3-2-4-10(11)20-12/h2-4H,5-8H2,1H3,(H,13,14) |
| InChIKey | FAEWODJFGHPCMM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|