C12H17N5O — CID 83004120
2-N-(4-methylpiperazin-1-yl)-1,3-benzoxazole-2,4-diamine (PubChem CID 83004120) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-N-(4-methylpiperazin-1-yl)-1,3-benzoxazole-2,4-diamine.
| Compound Name | 2-N-(4-methylpiperazin-1-yl)-1,3-benzoxazole-2,4-diamine |
|---|---|
| PubChem CID | 83004120 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-N-(4-methylpiperazin-1-yl)-1,3-benzoxazole-2,4-diamine |
| SMILES | CN1CCN(Nc2nc3c(N)cccc3o2)CC1 |
| InChI | InChI=1S/C12H17N5O/c1-16-5-7-17(8-6-16)15-12-14-11-9(13)3-2-4-10(11)18-12/h2-4H,5-8,13H2,1H3,(H,14,15) |
| InChIKey | NFVICYTWQUEOBP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|