C12H14N4O2 — CID 79995960
1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-3-methylimidazolidin-2-one (PubChem CID 79995960) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-3-methylimidazolidin-2-one.
| Compound Name | 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-3-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 79995960 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-3-methylimidazolidin-2-one |
| SMILES | CN1CCN(Cc2nc3c(N)cccc3o2)C1=O |
| InChI | InChI=1S/C12H14N4O2/c1-15-5-6-16(12(15)17)7-10-14-11-8(13)3-2-4-9(11)18-10/h2-4H,5-7,13H2,1H3 |
| InChIKey | LJYVVFVNZLYMNT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|