C14H15N3O3 — CID 79996159
1-[(4-amino-1,3-benzoxazol-2-yl)methyl]azepane-2,7-dione (PubChem CID 79996159) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]azepane-2,7-dione.
| Compound Name | 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]azepane-2,7-dione |
|---|---|
| PubChem CID | 79996159 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]azepane-2,7-dione |
| SMILES | Nc1cccc2oc(CN3C(=O)CCCCC3=O)nc12 |
| InChI | InChI=1S/C14H15N3O3/c15-9-4-3-5-10-14(9)16-11(20-10)8-17-12(18)6-1-2-7-13(17)19/h3-5H,1-2,6-8,15H2 |
| InChIKey | NPXNUTMAQUUOGY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|