About 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-5-bromopyrimidine-2,4-dione
1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-5-bromopyrimidine-2,4-dione (PubChem CID 79999044) has the molecular formula C12H9BrN4O3
and a molecular weight of 337.13 g/mol. Its IUPAC name is 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-5-bromopyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-5-bromopyrimidine-2,4-dione |
| PubChem CID | 79999044 |
| Molecular Formula | C12H9BrN4O3 |
| Molecular Weight | 337.13 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-5-bromopyrimidine-2,4-dione |
| SMILES | Nc1cccc2oc(Cn3cc(Br)c(=O)[nH]c3=O)nc12 |
| InChI | InChI=1S/C12H9BrN4O3/c13-6-4-17(12(19)16-11(6)18)5-9-15-10-7(14)2-1-3-8(10)20-9/h1-4H,5,14H2,(H,16,18,19) |
| InChIKey | DKCIBUFQTJTXPL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.13 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-5-bromopyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-5-bromopyrimidine-2,4-dione?
The IUPAC name of 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-5-bromopyrimidine-2,4-dione (CID 79999044) is 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-5-bromopyrimidine-2,4-dione.
What is the SMILES notation for 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-5-bromopyrimidine-2,4-dione?
The canonical SMILES for 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-5-bromopyrimidine-2,4-dione is Nc1cccc2oc(Cn3cc(Br)c(=O)[nH]c3=O)nc12.
What is the InChIKey of 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-5-bromopyrimidine-2,4-dione?
The InChIKey is DKCIBUFQTJTXPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrN4O3/c13-6-4-17(12(19)16-11(6)18)5-9-15-10-7(14)2-1-3-8(10)20-9/h1-4H,5,14H2,(H,16,18,19).
What are the key properties of 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-5-bromopyrimidine-2,4-dione?
1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-5-bromopyrimidine-2,4-dione has a molecular weight of 337.13 g/mol, XLogP of 1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-amino-1,3-benzoxazol-2-yl)methyl]-5-bromopyrimidine-2,4-dione is sourced from PubChem (CID 79999044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).