C12H15N3O — CID 79890379
2-piperidin-1-yl-1,3-benzoxazol-4-amine (PubChem CID 79890379) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-piperidin-1-yl-1,3-benzoxazol-4-amine.
| Compound Name | 2-piperidin-1-yl-1,3-benzoxazol-4-amine |
|---|---|
| PubChem CID | 79890379 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-piperidin-1-yl-1,3-benzoxazol-4-amine |
| SMILES | Nc1cccc2oc(N3CCCCC3)nc12 |
| InChI | InChI=1S/C12H15N3O/c13-9-5-4-6-10-11(9)14-12(16-10)15-7-2-1-3-8-15/h4-6H,1-3,7-8,13H2 |
| InChIKey | NIEOPXKKHWLTDJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|