C13H16N4O2 — CID 102888293
4-(4-amino-1,3-benzoxazol-2-yl)-1-methyl-1,4-diazepan-2-one (PubChem CID 102888293) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-(4-amino-1,3-benzoxazol-2-yl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(4-amino-1,3-benzoxazol-2-yl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102888293 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-(4-amino-1,3-benzoxazol-2-yl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(c2nc3c(N)cccc3o2)CC1=O |
| InChI | InChI=1S/C13H16N4O2/c1-16-6-3-7-17(8-11(16)18)13-15-12-9(14)4-2-5-10(12)19-13/h2,4-5H,3,6-8,14H2,1H3 |
| InChIKey | RISCSNGJFYZRBI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|