C11H11N5O — CID 79892960
2-(3,5-dimethyl-1,2,4-triazol-1-yl)-1,3-benzoxazol-4-amine (PubChem CID 79892960) has the molecular formula C11H11N5O and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2,4-triazol-1-yl)-1,3-benzoxazol-4-amine.
| Compound Name | 2-(3,5-dimethyl-1,2,4-triazol-1-yl)-1,3-benzoxazol-4-amine |
|---|---|
| PubChem CID | 79892960 |
| Molecular Formula | C11H11N5O |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-(3,5-dimethyl-1,2,4-triazol-1-yl)-1,3-benzoxazol-4-amine |
| SMILES | Cc1nc(C)n(-c2nc3c(N)cccc3o2)n1 |
| InChI | InChI=1S/C11H11N5O/c1-6-13-7(2)16(15-6)11-14-10-8(12)4-3-5-9(10)17-11/h3-5H,12H2,1-2H3 |
| InChIKey | AALMLUNCGGMSNW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|