About 11-nitropyrido[3,2-a]phenoxazin-5-one
11-nitropyrido[3,2-a]phenoxazin-5-one (PubChem CID 11011818) has the molecular formula C15H7N3O4
and a molecular weight of 293.24 g/mol. Its IUPAC name is 11-nitropyrido[3,2-a]phenoxazin-5-one.
Molecular Properties
| Compound Name | 11-nitropyrido[3,2-a]phenoxazin-5-one |
| PubChem CID | 11011818 |
| Molecular Formula | C15H7N3O4 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 11-nitropyrido[3,2-a]phenoxazin-5-one |
| SMILES | O=c1cc2oc3cccc([N+](=O)[O-])c3nc-2c2cccnc12 |
| InChI | InChI=1S/C15H7N3O4/c19-10-7-12-14(8-3-2-6-16-13(8)10)17-15-9(18(20)21)4-1-5-11(15)22-12/h1-7H |
| InChIKey | WYDQMMKPTIOTBC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 99.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 11-nitropyrido[3,2-a]phenoxazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-nitropyrido[3,2-a]phenoxazin-5-one?
The IUPAC name of 11-nitropyrido[3,2-a]phenoxazin-5-one (CID 11011818) is 11-nitropyrido[3,2-a]phenoxazin-5-one.
What is the SMILES notation for 11-nitropyrido[3,2-a]phenoxazin-5-one?
The canonical SMILES for 11-nitropyrido[3,2-a]phenoxazin-5-one is O=c1cc2oc3cccc([N+](=O)[O-])c3nc-2c2cccnc12.
What is the InChIKey of 11-nitropyrido[3,2-a]phenoxazin-5-one?
The InChIKey is WYDQMMKPTIOTBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7N3O4/c19-10-7-12-14(8-3-2-6-16-13(8)10)17-15-9(18(20)21)4-1-5-11(15)22-12/h1-7H.
What are the key properties of 11-nitropyrido[3,2-a]phenoxazin-5-one?
11-nitropyrido[3,2-a]phenoxazin-5-one has a molecular weight of 293.24 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 11-nitropyrido[3,2-a]phenoxazin-5-one is sourced from PubChem (CID 11011818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).