C20H11NO4 — CID 11724094
8-methyl-5,13-dioxa-2-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),7,10,14,17,19,21-nonaene-6,16-dione (PubChem CID 11724094) has the molecular formula C20H11NO4 and a molecular weight of 329.31 g/mol. Its IUPAC name is 8-methyl-5,13-dioxa-2-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),7,10,14,17,19,21-nonaene-6,16-dione.
| Compound Name | 8-methyl-5,13-dioxa-2-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),7,10,14,17,19,21-nonaene-6,16-dione |
|---|---|
| PubChem CID | 11724094 |
| Molecular Formula | C20H11NO4 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 8-methyl-5,13-dioxa-2-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),7,10,14,17,19,21-nonaene-6,16-dione |
| SMILES | Cc1cc(=O)oc2c1ccc1oc3cc(=O)c4ccccc4c-3nc12 |
| InChI | InChI=1S/C20H11NO4/c1-10-8-17(23)25-20-11(10)6-7-15-19(20)21-18-13-5-3-2-4-12(13)14(22)9-16(18)24-15/h2-9H,1H3 |
| InChIKey | KVGHKLVFVBXTAG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 73.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|