C17H10ClNO3 — CID 86105930
2-(2-chlorophenyl)-6-methylpyrano[2,3-e][1,3]benzoxazol-8-one (PubChem CID 86105930) has the molecular formula C17H10ClNO3 and a molecular weight of 311.72 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-6-methylpyrano[2,3-e][1,3]benzoxazol-8-one.
| Compound Name | 2-(2-chlorophenyl)-6-methylpyrano[2,3-e][1,3]benzoxazol-8-one |
|---|---|
| PubChem CID | 86105930 |
| Molecular Formula | C17H10ClNO3 |
| Molecular Weight | 311.72 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 2-(2-chlorophenyl)-6-methylpyrano[2,3-e][1,3]benzoxazol-8-one |
| SMILES | Cc1cc(=O)oc2c1ccc1oc(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C17H10ClNO3/c1-9-8-14(20)22-16-10(9)6-7-13-15(16)19-17(21-13)11-4-2-3-5-12(11)18/h2-8H,1H3 |
| InChIKey | JGVHZGZJBDXIDT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.72 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|