C10H17N3O2 — CID 143847945
ethane;3-methyl-6,7,8,9-tetrahydropyrido[1,2-a][1,3,5]triazine-2,4-dione (PubChem CID 143847945) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is ethane;3-methyl-6,7,8,9-tetrahydropyrido[1,2-a][1,3,5]triazine-2,4-dione.
| Compound Name | ethane;3-methyl-6,7,8,9-tetrahydropyrido[1,2-a][1,3,5]triazine-2,4-dione |
|---|---|
| PubChem CID | 143847945 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | ethane;3-methyl-6,7,8,9-tetrahydropyrido[1,2-a][1,3,5]triazine-2,4-dione |
| SMILES | CC.Cn1c(=O)nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C8H11N3O2.C2H6/c1-10-7(12)9-6-4-2-3-5-11(6)8(10)13;1-2/h2-5H2,1H3;1-2H3 |
| InChIKey | SFWMCXPQYAWDHO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |