About 1,3,5,8-tetrazatricyclo[7.4.0.03,7]trideca-4,6,8-trien-2-one
1,3,5,8-tetrazatricyclo[7.4.0.03,7]trideca-4,6,8-trien-2-one (PubChem CID 130467018) has the molecular formula C9H10N4O
and a molecular weight of 190.21 g/mol. Its IUPAC name is 1,3,5,8-tetrazatricyclo[7.4.0.03,7]trideca-4,6,8-trien-2-one.
Analyze 1,3,5,8-tetrazatricyclo[7.4.0.03,7]trideca-4,6,8-trien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5,8-tetrazatricyclo[7.4.0.03,7]trideca-4,6,8-trien-2-one?
The IUPAC name of 1,3,5,8-tetrazatricyclo[7.4.0.03,7]trideca-4,6,8-trien-2-one (CID 130467018) is 1,3,5,8-tetrazatricyclo[7.4.0.03,7]trideca-4,6,8-trien-2-one.
What is the SMILES notation for 1,3,5,8-tetrazatricyclo[7.4.0.03,7]trideca-4,6,8-trien-2-one?
The canonical SMILES for 1,3,5,8-tetrazatricyclo[7.4.0.03,7]trideca-4,6,8-trien-2-one is O=c1n2c(nc3cncn13)CCCC2.
What is the InChIKey of 1,3,5,8-tetrazatricyclo[7.4.0.03,7]trideca-4,6,8-trien-2-one?
The InChIKey is YYCWLNZWNQSVRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O/c14-9-12-4-2-1-3-7(12)11-8-5-10-6-13(8)9/h5-6H,1-4H2.
What are the key properties of 1,3,5,8-tetrazatricyclo[7.4.0.03,7]trideca-4,6,8-trien-2-one?
1,3,5,8-tetrazatricyclo[7.4.0.03,7]trideca-4,6,8-trien-2-one has a molecular weight of 190.21 g/mol, XLogP of 0.23, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5,8-tetrazatricyclo[7.4.0.03,7]trideca-4,6,8-trien-2-one is sourced from PubChem (CID 130467018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).