C11H20N4O2 — CID 62936134
2-[3-(ethylamino)-2-hydroxypropyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 62936134) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-[3-(ethylamino)-2-hydroxypropyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[3-(ethylamino)-2-hydroxypropyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 62936134 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 2-[3-(ethylamino)-2-hydroxypropyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | CCNCC(O)Cn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C11H20N4O2/c1-2-12-7-9(16)8-15-11(17)14-6-4-3-5-10(14)13-15/h9,12,16H,2-8H2,1H3 |
| InChIKey | GHTILWGESNLSNT-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |