C28H23NO2S — CID 10812881
(E)-3-[1-phenyl-2-(4-phenylsulfanylphenyl)-6,7-dihydro-5H-pyrrolizin-3-yl]prop-2-enoic acid (PubChem CID 10812881) has the molecular formula C28H23NO2S and a molecular weight of 437.56 g/mol. Its IUPAC name is (E)-3-[1-phenyl-2-(4-phenylsulfanylphenyl)-6,7-dihydro-5H-pyrrolizin-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-phenyl-2-(4-phenylsulfanylphenyl)-6,7-dihydro-5H-pyrrolizin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10812881 |
| Molecular Formula | C28H23NO2S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | (E)-3-[1-phenyl-2-(4-phenylsulfanylphenyl)-6,7-dihydro-5H-pyrrolizin-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1c(-c2ccc(Sc3ccccc3)cc2)c(-c2ccccc2)c2n1CCC2 |
| InChI | InChI=1S/C28H23NO2S/c30-26(31)18-17-25-28(21-13-15-23(16-14-21)32-22-10-5-2-6-11-22)27(20-8-3-1-4-9-20)24-12-7-19-29(24)25/h1-6,8-11,13-18H,7,12,19H2,(H,30,31)/b18-17+ |
| InChIKey | ZJDCWFWIPZBPAP-ISLYRVAYSA-N |
| XLogP | 7.02 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|