C21H17ClN2O3 — CID 10339773
2-[2-(4-chlorophenyl)-1-phenyl-6,7-dihydro-5H-pyrrolizin-3-yl]-N-hydroxy-2-oxoacetamide (PubChem CID 10339773) has the molecular formula C21H17ClN2O3 and a molecular weight of 380.83 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-1-phenyl-6,7-dihydro-5H-pyrrolizin-3-yl]-N-hydroxy-2-oxoacetamide.
| Compound Name | 2-[2-(4-chlorophenyl)-1-phenyl-6,7-dihydro-5H-pyrrolizin-3-yl]-N-hydroxy-2-oxoacetamide |
|---|---|
| PubChem CID | 10339773 |
| Molecular Formula | C21H17ClN2O3 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-1-phenyl-6,7-dihydro-5H-pyrrolizin-3-yl]-N-hydroxy-2-oxoacetamide |
| SMILES | O=C(NO)C(=O)c1c(-c2ccc(Cl)cc2)c(-c2ccccc2)c2n1CCC2 |
| InChI | InChI=1S/C21H17ClN2O3/c22-15-10-8-14(9-11-15)18-17(13-5-2-1-3-6-13)16-7-4-12-24(16)19(18)20(25)21(26)23-27/h1-3,5-6,8-11,27H,4,7,12H2,(H,23,26) |
| InChIKey | INNLEZKWNYFRQH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|