C33H30FNO5P+ — CID 67714580
[1-[6-benzhydryl-4-(4-fluorophenyl)-2-propan-2-yl-3-pyridinyl]-3-carboxy-4-hydroxypent-1-yn-3-yl]-hydroxy-oxophosphanium (PubChem CID 67714580) has the molecular formula C33H30FNO5P+ and a molecular weight of 570.58 g/mol. Its IUPAC name is [1-[6-benzhydryl-4-(4-fluorophenyl)-2-propan-2-yl-3-pyridinyl]-3-carboxy-4-hydroxypent-1-yn-3-yl]-hydroxy-oxophosphanium.
| Compound Name | [1-[6-benzhydryl-4-(4-fluorophenyl)-2-propan-2-yl-3-pyridinyl]-3-carboxy-4-hydroxypent-1-yn-3-yl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 67714580 |
| Molecular Formula | C33H30FNO5P+ |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | [1-[6-benzhydryl-4-(4-fluorophenyl)-2-propan-2-yl-3-pyridinyl]-3-carboxy-4-hydroxypent-1-yn-3-yl]-hydroxy-oxophosphanium |
| SMILES | CC(C)c1nc(C(c2ccccc2)c2ccccc2)cc(-c2ccc(F)cc2)c1C#CC(C(=O)O)(C(C)O)[P+](=O)O |
| InChI | InChI=1S/C33H29FNO5P/c1-21(2)31-27(18-19-33(22(3)36,32(37)38)41(39)40)28(23-14-16-26(34)17-15-23)20-29(35-31)30(24-10-6-4-7-11-24)25-12-8-5-9-13-25/h4-17,20-22,30,36H,1-3H3,(H-,37,38,39,40)/p+1 |
| InChIKey | BXQHCZLJWXYWHN-UHFFFAOYSA-O |
| XLogP | 6.48 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|