C22H20FN — CID 19867626
3-ethenyl-4-(4-fluorophenyl)-6-phenyl-2-propan-2-ylpyridine (PubChem CID 19867626) has the molecular formula C22H20FN and a molecular weight of 317.41 g/mol. Its IUPAC name is 3-ethenyl-4-(4-fluorophenyl)-6-phenyl-2-propan-2-ylpyridine.
| Compound Name | 3-ethenyl-4-(4-fluorophenyl)-6-phenyl-2-propan-2-ylpyridine |
|---|---|
| PubChem CID | 19867626 |
| Molecular Formula | C22H20FN |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3-ethenyl-4-(4-fluorophenyl)-6-phenyl-2-propan-2-ylpyridine |
| SMILES | C=Cc1c(-c2ccc(F)cc2)cc(-c2ccccc2)nc1C(C)C |
| InChI | InChI=1S/C22H20FN/c1-4-19-20(16-10-12-18(23)13-11-16)14-21(24-22(19)15(2)3)17-8-6-5-7-9-17/h4-15H,1H2,2-3H3 |
| InChIKey | OBUHQXMIXDEWLS-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |