C25H26FN — CID 142622578
4-(4-fluorophenyl)-3-[(E)-3-methylbut-1-enyl]-6-phenyl-2-propan-2-ylpyridine (PubChem CID 142622578) has the molecular formula C25H26FN and a molecular weight of 359.49 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3-[(E)-3-methylbut-1-enyl]-6-phenyl-2-propan-2-ylpyridine.
| Compound Name | 4-(4-fluorophenyl)-3-[(E)-3-methylbut-1-enyl]-6-phenyl-2-propan-2-ylpyridine |
|---|---|
| PubChem CID | 142622578 |
| Molecular Formula | C25H26FN |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 4-(4-fluorophenyl)-3-[(E)-3-methylbut-1-enyl]-6-phenyl-2-propan-2-ylpyridine |
| SMILES | CC(C)/C=C/c1c(-c2ccc(F)cc2)cc(-c2ccccc2)nc1C(C)C |
| InChI | InChI=1S/C25H26FN/c1-17(2)10-15-22-23(19-11-13-21(26)14-12-19)16-24(27-25(22)18(3)4)20-8-6-5-7-9-20/h5-18H,1-4H3/b15-10+ |
| InChIKey | JFRMGAGPMVBOFK-XNTDXEJSSA-N |
| XLogP | 7.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |