C21H24FNO2 — CID 21471334
6-cyclohexyl-4-(4-fluorophenyl)-2-propan-2-ylpyridine-3-carboxylic acid (PubChem CID 21471334) has the molecular formula C21H24FNO2 and a molecular weight of 341.43 g/mol. Its IUPAC name is 6-cyclohexyl-4-(4-fluorophenyl)-2-propan-2-ylpyridine-3-carboxylic acid.
| Compound Name | 6-cyclohexyl-4-(4-fluorophenyl)-2-propan-2-ylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 21471334 |
| Molecular Formula | C21H24FNO2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 6-cyclohexyl-4-(4-fluorophenyl)-2-propan-2-ylpyridine-3-carboxylic acid |
| SMILES | CC(C)c1nc(C2CCCCC2)cc(-c2ccc(F)cc2)c1C(=O)O |
| InChI | InChI=1S/C21H24FNO2/c1-13(2)20-19(21(24)25)17(14-8-10-16(22)11-9-14)12-18(23-20)15-6-4-3-5-7-15/h8-13,15H,3-7H2,1-2H3,(H,24,25) |
| InChIKey | PMFZDXOKNQLQGT-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |