C16H12FO3- — CID 131746407
2-carboxy-4-cyclopropyl-5-(4-fluorophenyl)phenolate (PubChem CID 131746407) has the molecular formula C16H12FO3- and a molecular weight of 271.27 g/mol. Its IUPAC name is 2-carboxy-4-cyclopropyl-5-(4-fluorophenyl)phenolate.
| Compound Name | 2-carboxy-4-cyclopropyl-5-(4-fluorophenyl)phenolate |
|---|---|
| PubChem CID | 131746407 |
| Molecular Formula | C16H12FO3- |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-carboxy-4-cyclopropyl-5-(4-fluorophenyl)phenolate |
| SMILES | O=C(O)c1cc(C2CC2)c(-c2ccc(F)cc2)cc1[O-] |
| InChI | InChI=1S/C16H13FO3/c17-11-5-3-10(4-6-11)13-8-15(18)14(16(19)20)7-12(13)9-1-2-9/h3-9,18H,1-2H2,(H,19,20)/p-1 |
| InChIKey | SCLJCPKRNILHQT-UHFFFAOYSA-M |
| XLogP | 3.14 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |