C18H22FNO4 — CID 68747995
2-carboxy-4-(4-fluorophenyl)phenolate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 68747995) has the molecular formula C18H22FNO4 and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-carboxy-4-(4-fluorophenyl)phenolate;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 2-carboxy-4-(4-fluorophenyl)phenolate;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 68747995 |
| Molecular Formula | C18H22FNO4 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-carboxy-4-(4-fluorophenyl)phenolate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.O=C(O)c1cc(-c2ccc(F)cc2)ccc1[O-] |
| InChI | InChI=1S/C13H9FO3.C5H14NO/c14-10-4-1-8(2-5-10)9-3-6-12(15)11(7-9)13(16)17;1-6(2,3)4-5-7/h1-7,15H,(H,16,17);7H,4-5H2,1-3H3/q;+1/p-1 |
| InChIKey | OWUHOJJKBNVFDW-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|