About 2-carboxyphenolate;trimethyl(prop-2-enyl)azanium
2-carboxyphenolate;trimethyl(prop-2-enyl)azanium (PubChem CID 70450706) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-carboxyphenolate;trimethyl(prop-2-enyl)azanium.
Molecular Properties
| Compound Name | 2-carboxyphenolate;trimethyl(prop-2-enyl)azanium |
| PubChem CID | 70450706 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-carboxyphenolate;trimethyl(prop-2-enyl)azanium |
| SMILES | C=CC[N+](C)(C)C.O=C(O)c1ccccc1[O-] |
| InChI | InChI=1S/C7H6O3.C6H14N/c8-6-4-2-1-3-5(6)7(9)10;1-5-6-7(2,3)4/h1-4,8H,(H,9,10);5H,1,6H2,2-4H3/q;+1/p-1 |
| InChIKey | PSHXNZXCKLQJMW-UHFFFAOYSA-M |
| XLogP | 1.34 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-carboxyphenolate;trimethyl(prop-2-enyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxyphenolate;trimethyl(prop-2-enyl)azanium?
The IUPAC name of 2-carboxyphenolate;trimethyl(prop-2-enyl)azanium (CID 70450706) is 2-carboxyphenolate;trimethyl(prop-2-enyl)azanium.
What is the SMILES notation for 2-carboxyphenolate;trimethyl(prop-2-enyl)azanium?
The canonical SMILES for 2-carboxyphenolate;trimethyl(prop-2-enyl)azanium is C=CC[N+](C)(C)C.O=C(O)c1ccccc1[O-].
What is the InChIKey of 2-carboxyphenolate;trimethyl(prop-2-enyl)azanium?
The InChIKey is PSHXNZXCKLQJMW-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O3.C6H14N/c8-6-4-2-1-3-5(6)7(9)10;1-5-6-7(2,3)4/h1-4,8H,(H,9,10);5H,1,6H2,2-4H3/q;+1/p-1.
What are the key properties of 2-carboxyphenolate;trimethyl(prop-2-enyl)azanium?
2-carboxyphenolate;trimethyl(prop-2-enyl)azanium has a molecular weight of 237.30 g/mol, XLogP of 1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxyphenolate;trimethyl(prop-2-enyl)azanium is sourced from PubChem (CID 70450706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).