C12H20ClNO4 — CID 174928429
2-hydroxybenzoic acid;2-hydroxyethyl(trimethyl)azanium;chloride (PubChem CID 174928429) has the molecular formula C12H20ClNO4 and a molecular weight of 277.75 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;2-hydroxyethyl(trimethyl)azanium;chloride.
| Compound Name | 2-hydroxybenzoic acid;2-hydroxyethyl(trimethyl)azanium;chloride |
|---|---|
| PubChem CID | 174928429 |
| Molecular Formula | C12H20ClNO4 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-hydroxybenzoic acid;2-hydroxyethyl(trimethyl)azanium;chloride |
| SMILES | C[N+](C)(C)CCO.O=C(O)c1ccccc1O.[Cl-] |
| InChI | InChI=1S/C7H6O3.C5H14NO.ClH/c8-6-4-2-1-3-5(6)7(9)10;1-6(2,3)4-5-7;/h1-4,8H,(H,9,10);7H,4-5H2,1-3H3;1H/q;+1;/p-1 |
| InChIKey | CELQOJRSSPVLGP-UHFFFAOYSA-M |
| XLogP | -2.22 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|