C12H19NO6S — CID 70601958
2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium;sulfur dioxide (PubChem CID 70601958) has the molecular formula C12H19NO6S and a molecular weight of 305.35 g/mol. Its IUPAC name is 2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium;sulfur dioxide.
| Compound Name | 2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium;sulfur dioxide |
|---|---|
| PubChem CID | 70601958 |
| Molecular Formula | C12H19NO6S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-carboxyphenolate;2-hydroxyethyl(trimethyl)azanium;sulfur dioxide |
| SMILES | C[N+](C)(C)CCO.O=C(O)c1ccccc1[O-].O=S=O |
| InChI | InChI=1S/C7H6O3.C5H14NO.O2S/c8-6-4-2-1-3-5(6)7(9)10;1-6(2,3)4-5-7;1-3-2/h1-4,8H,(H,9,10);7H,4-5H2,1-3H3;/q;+1;/p-1 |
| InChIKey | SXTAAWSQCCTXKI-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|