C12H18MgNO4+ — CID 131698602
magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate (PubChem CID 131698602) has the molecular formula C12H18MgNO4+ and a molecular weight of 264.58 g/mol. Its IUPAC name is magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate.
| Compound Name | magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate |
|---|---|
| PubChem CID | 131698602 |
| Molecular Formula | C12H18MgNO4+ |
| Molecular Weight | 264.58 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate |
| SMILES | C[N+](C)(C)CCO.O=C([O-])c1ccccc1[O-].[Mg+2] |
| InChI | InChI=1S/C7H6O3.C5H14NO.Mg/c8-6-4-2-1-3-5(6)7(9)10;1-6(2,3)4-5-7;/h1-4,8H,(H,9,10);7H,4-5H2,1-3H3;/q;+1;+2/p-2 |
| InChIKey | BZYMCGIBACHYII-UHFFFAOYSA-L |
| XLogP | -1.57 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.58 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|