About magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate
magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate (PubChem CID 131698602) has the molecular formula C12H18MgNO4+
and a molecular weight of 264.58 g/mol. Its IUPAC name is magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate.
Molecular Properties
| Compound Name | magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate |
| PubChem CID | 131698602 |
| Molecular Formula | C12H18MgNO4+ |
| Molecular Weight | 264.58 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate |
| SMILES | C[N+](C)(C)CCO.O=C([O-])c1ccccc1[O-].[Mg+2] |
| InChI | InChI=1S/C7H6O3.C5H14NO.Mg/c8-6-4-2-1-3-5(6)7(9)10;1-6(2,3)4-5-7;/h1-4,8H,(H,9,10);7H,4-5H2,1-3H3;/q;+1;+2/p-2 |
| InChIKey | BZYMCGIBACHYII-UHFFFAOYSA-L |
| XLogP | -1.57 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.58 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate?
The IUPAC name of magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate (CID 131698602) is magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate.
What is the SMILES notation for magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate?
The canonical SMILES for magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate is C[N+](C)(C)CCO.O=C([O-])c1ccccc1[O-].[Mg+2].
What is the InChIKey of magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate?
The InChIKey is BZYMCGIBACHYII-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H6O3.C5H14NO.Mg/c8-6-4-2-1-3-5(6)7(9)10;1-6(2,3)4-5-7;/h1-4,8H,(H,9,10);7H,4-5H2,1-3H3;/q;+1;+2/p-2.
What are the key properties of magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate?
magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate has a molecular weight of 264.58 g/mol, XLogP of -1.57, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-hydroxyethyl(trimethyl)azanium;2-oxidobenzoate is sourced from PubChem (CID 131698602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).