C14H22BiNO6+4 — CID 88801440
bismuth;2-(2-hydroxybenzoyl)oxyacetic acid;2-hydroxyethyl(trimethyl)azanium (PubChem CID 88801440) has the molecular formula C14H22BiNO6+4 and a molecular weight of 509.31 g/mol. Its IUPAC name is bismuth;2-(2-hydroxybenzoyl)oxyacetic acid;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | bismuth;2-(2-hydroxybenzoyl)oxyacetic acid;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 88801440 |
| Molecular Formula | C14H22BiNO6+4 |
| Molecular Weight | 509.31 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | bismuth;2-(2-hydroxybenzoyl)oxyacetic acid;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.O=C(O)COC(=O)c1ccccc1O.[Bi+3] |
| InChI | InChI=1S/C9H8O5.C5H14NO.Bi/c10-7-4-2-1-3-6(7)9(13)14-5-8(11)12;1-6(2,3)4-5-7;/h1-4,10H,5H2,(H,11,12);7H,4-5H2,1-3H3;/q;+1;+3 |
| InChIKey | HPQPRJHHQYCXTQ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|