C19H23MgNO6 — CID 66765974
CID 66765974 (PubChem CID 66765974) has the molecular formula C19H23MgNO6 and a molecular weight of 385.70 g/mol.
| Compound Name | CID 66765974 |
|---|---|
| PubChem CID | 66765974 |
| Molecular Formula | C19H23MgNO6 |
| Molecular Weight | 385.70 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | — |
| SMILES | C[N+](C)(C)CCOC(=O)c1ccccc1O.O=C(O)c1ccccc1[O-].[Mg] |
| InChI | InChI=1S/C12H17NO3.C7H6O3.Mg/c1-13(2,3)8-9-16-12(15)10-6-4-5-7-11(10)14;8-6-4-2-1-3-5(6)7(9)10;/h4-7H,8-9H2,1-3H3;1-4,8H,(H,9,10); |
| InChIKey | ANSAYJKKNFMAJC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.70 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|