C16H27N2O7+ — CID 121364923
2-acetyloxybenzoic acid;2-aminoacetic acid;2-hydroxyethyl(trimethyl)azanium (PubChem CID 121364923) has the molecular formula C16H27N2O7+ and a molecular weight of 359.40 g/mol. Its IUPAC name is 2-acetyloxybenzoic acid;2-aminoacetic acid;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 2-acetyloxybenzoic acid;2-aminoacetic acid;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 121364923 |
| Molecular Formula | C16H27N2O7+ |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 2-acetyloxybenzoic acid;2-aminoacetic acid;2-hydroxyethyl(trimethyl)azanium |
| SMILES | CC(=O)Oc1ccccc1C(=O)O.C[N+](C)(C)CCO.NCC(=O)O |
| InChI | InChI=1S/C9H8O4.C5H14NO.C2H5NO2/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;1-6(2,3)4-5-7;3-1-2(4)5/h2-5H,1H3,(H,11,12);7H,4-5H2,1-3H3;1,3H2,(H,4,5)/q;+1; |
| InChIKey | HEFIBSJOUDWSIO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|