C22H24F2O3 — CID 67939819
2-fluoro-4-(4-fluorophenyl)-3-(4-propoxycyclohexyl)benzoic acid (PubChem CID 67939819) has the molecular formula C22H24F2O3 and a molecular weight of 374.43 g/mol. Its IUPAC name is 2-fluoro-4-(4-fluorophenyl)-3-(4-propoxycyclohexyl)benzoic acid.
| Compound Name | 2-fluoro-4-(4-fluorophenyl)-3-(4-propoxycyclohexyl)benzoic acid |
|---|---|
| PubChem CID | 67939819 |
| Molecular Formula | C22H24F2O3 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-fluoro-4-(4-fluorophenyl)-3-(4-propoxycyclohexyl)benzoic acid |
| SMILES | CCCOC1CCC(c2c(-c3ccc(F)cc3)ccc(C(=O)O)c2F)CC1 |
| InChI | InChI=1S/C22H24F2O3/c1-2-13-27-17-9-5-15(6-10-17)20-18(14-3-7-16(23)8-4-14)11-12-19(21(20)24)22(25)26/h3-4,7-8,11-12,15,17H,2,5-6,9-10,13H2,1H3,(H,25,26) |
| InChIKey | IBZDZFZJEDTLJW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |