C23H26F2O3 — CID 67939757
3-(4-butoxycyclohexyl)-2-fluoro-4-(4-fluorophenyl)benzoic acid (PubChem CID 67939757) has the molecular formula C23H26F2O3 and a molecular weight of 388.45 g/mol. Its IUPAC name is 3-(4-butoxycyclohexyl)-2-fluoro-4-(4-fluorophenyl)benzoic acid.
| Compound Name | 3-(4-butoxycyclohexyl)-2-fluoro-4-(4-fluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 67939757 |
| Molecular Formula | C23H26F2O3 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 3-(4-butoxycyclohexyl)-2-fluoro-4-(4-fluorophenyl)benzoic acid |
| SMILES | CCCCOC1CCC(c2c(-c3ccc(F)cc3)ccc(C(=O)O)c2F)CC1 |
| InChI | InChI=1S/C23H26F2O3/c1-2-3-14-28-18-10-6-16(7-11-18)21-19(15-4-8-17(24)9-5-15)12-13-20(22(21)25)23(26)27/h4-5,8-9,12-13,16,18H,2-3,6-7,10-11,14H2,1H3,(H,26,27) |
| InChIKey | OHICKMHUZVTFDC-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|