C19H21F — CID 129143320
1-cyclopropyl-4,5-diethyl-2-(4-fluorophenyl)benzene (PubChem CID 129143320) has the molecular formula C19H21F and a molecular weight of 268.38 g/mol. Its IUPAC name is 1-cyclopropyl-4,5-diethyl-2-(4-fluorophenyl)benzene.
| Compound Name | 1-cyclopropyl-4,5-diethyl-2-(4-fluorophenyl)benzene |
|---|---|
| PubChem CID | 129143320 |
| Molecular Formula | C19H21F |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-cyclopropyl-4,5-diethyl-2-(4-fluorophenyl)benzene |
| SMILES | CCc1cc(-c2ccc(F)cc2)c(C2CC2)cc1CC |
| InChI | InChI=1S/C19H21F/c1-3-13-11-18(15-5-6-15)19(12-14(13)4-2)16-7-9-17(20)10-8-16/h7-12,15H,3-6H2,1-2H3 |
| InChIKey | BRAVJPQONHVPBA-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |