About 4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid
4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid (PubChem CID 91327254) has the molecular formula C21H22FO5P
and a molecular weight of 404.37 g/mol. Its IUPAC name is 4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid |
| PubChem CID | 91327254 |
| Molecular Formula | C21H22FO5P |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid |
| SMILES | Cc1cccc(-c2cc(C)c(F)c(C)c2C=CP(=O)(O)CC(=O)CC(=O)O)c1 |
| InChI | InChI=1S/C21H22FO5P/c1-13-5-4-6-16(9-13)19-10-14(2)21(22)15(3)18(19)7-8-28(26,27)12-17(23)11-20(24)25/h4-10H,11-12H2,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | JTKFKGLSTBAGEV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid?
The IUPAC name of 4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid (CID 91327254) is 4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid.
What is the SMILES notation for 4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid?
The canonical SMILES for 4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid is Cc1cccc(-c2cc(C)c(F)c(C)c2C=CP(=O)(O)CC(=O)CC(=O)O)c1.
What is the InChIKey of 4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid?
The InChIKey is JTKFKGLSTBAGEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FO5P/c1-13-5-4-6-16(9-13)19-10-14(2)21(22)15(3)18(19)7-8-28(26,27)12-17(23)11-20(24)25/h4-10H,11-12H2,1-3H3,(H,24,25)(H,26,27).
What are the key properties of 4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid?
4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid has a molecular weight of 404.37 g/mol, XLogP of 4.70, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid is sourced from PubChem (CID 91327254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).