C21H22FO5P — CID 91327254
4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid (PubChem CID 91327254) has the molecular formula C21H22FO5P and a molecular weight of 404.37 g/mol. Its IUPAC name is 4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid.
| Compound Name | 4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid |
|---|---|
| PubChem CID | 91327254 |
| Molecular Formula | C21H22FO5P |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 4-[2-[3-fluoro-2,4-dimethyl-6-(3-methylphenyl)phenyl]ethenyl-hydroxyphosphoryl]-3-oxobutanoic acid |
| SMILES | Cc1cccc(-c2cc(C)c(F)c(C)c2C=CP(=O)(O)CC(=O)CC(=O)O)c1 |
| InChI | InChI=1S/C21H22FO5P/c1-13-5-4-6-16(9-13)19-10-14(2)21(22)15(3)18(19)7-8-28(26,27)12-17(23)11-20(24)25/h4-10H,11-12H2,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | JTKFKGLSTBAGEV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|