C15H17O3P — CID 68829897
[3,6-dimethyl-2-(3-methylphenyl)phenyl]phosphonic acid (PubChem CID 68829897) has the molecular formula C15H17O3P and a molecular weight of 276.27 g/mol. Its IUPAC name is [3,6-dimethyl-2-(3-methylphenyl)phenyl]phosphonic acid.
| Compound Name | [3,6-dimethyl-2-(3-methylphenyl)phenyl]phosphonic acid |
|---|---|
| PubChem CID | 68829897 |
| Molecular Formula | C15H17O3P |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | [3,6-dimethyl-2-(3-methylphenyl)phenyl]phosphonic acid |
| SMILES | Cc1cccc(-c2c(C)ccc(C)c2P(=O)(O)O)c1 |
| InChI | InChI=1S/C15H17O3P/c1-10-5-4-6-13(9-10)14-11(2)7-8-12(3)15(14)19(16,17)18/h4-9H,1-3H3,(H2,16,17,18) |
| InChIKey | DBOLRVFODVGDII-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|