C15H16O — CID 101298795
3,5-dimethyl-4-(3-methylphenyl)phenol (PubChem CID 101298795) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is 3,5-dimethyl-4-(3-methylphenyl)phenol.
| Compound Name | 3,5-dimethyl-4-(3-methylphenyl)phenol |
|---|---|
| PubChem CID | 101298795 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 3,5-dimethyl-4-(3-methylphenyl)phenol |
| SMILES | Cc1cccc(-c2c(C)cc(O)cc2C)c1 |
| InChI | InChI=1S/C15H16O/c1-10-5-4-6-13(7-10)15-11(2)8-14(16)9-12(15)3/h4-9,16H,1-3H3 |
| InChIKey | OVVOOFKDYUUVBP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |