About 2-(3-methylphenyl)phenol
2-(3-methylphenyl)phenol (PubChem CID 11206198) has the molecular formula C13H12O
and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-(3-methylphenyl)phenol.
Molecular Properties
| Compound Name | 2-(3-methylphenyl)phenol |
| PubChem CID | 11206198 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 2-(3-methylphenyl)phenol |
| SMILES | Cc1cccc(-c2ccccc2O)c1 |
| InChI | InChI=1S/C13H12O/c1-10-5-4-6-11(9-10)12-7-2-3-8-13(12)14/h2-9,14H,1H3 |
| InChIKey | FBMMSJUIGAXYJJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3-methylphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylphenyl)phenol?
The IUPAC name of 2-(3-methylphenyl)phenol (CID 11206198) is 2-(3-methylphenyl)phenol.
What is the SMILES notation for 2-(3-methylphenyl)phenol?
The canonical SMILES for 2-(3-methylphenyl)phenol is Cc1cccc(-c2ccccc2O)c1.
What is the InChIKey of 2-(3-methylphenyl)phenol?
The InChIKey is FBMMSJUIGAXYJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O/c1-10-5-4-6-11(9-10)12-7-2-3-8-13(12)14/h2-9,14H,1H3.
What are the key properties of 2-(3-methylphenyl)phenol?
2-(3-methylphenyl)phenol has a molecular weight of 184.24 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylphenyl)phenol is sourced from PubChem (CID 11206198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).