C42H32O2 — CID 25054148
1,4,5,8-tetrakis(3-methylphenyl)anthracene-9,10-dione (PubChem CID 25054148) has the molecular formula C42H32O2 and a molecular weight of 568.72 g/mol. Its IUPAC name is 1,4,5,8-tetrakis(3-methylphenyl)anthracene-9,10-dione.
| Compound Name | 1,4,5,8-tetrakis(3-methylphenyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 25054148 |
| Molecular Formula | C42H32O2 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 1,4,5,8-tetrakis(3-methylphenyl)anthracene-9,10-dione |
| SMILES | Cc1cccc(-c2ccc(-c3cccc(C)c3)c3c2C(=O)c2c(-c4cccc(C)c4)ccc(-c4cccc(C)c4)c2C3=O)c1 |
| InChI | InChI=1S/C42H32O2/c1-25-9-5-13-29(21-25)33-17-18-34(30-14-6-10-26(2)22-30)38-37(33)41(43)39-35(31-15-7-11-27(3)23-31)19-20-36(40(39)42(38)44)32-16-8-12-28(4)24-32/h5-24H,1-4H3 |
| InChIKey | NMAYPXBZKRTHLU-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|