C24H29FNO5P — CID 54574705
(3S)-4-[2-[1-(4-fluorophenyl)-3-propan-2-ylindol-2-yl]ethyl-methoxyphosphoryl]-3-hydroxybutanoic acid (PubChem CID 54574705) has the molecular formula C24H29FNO5P and a molecular weight of 461.47 g/mol. Its IUPAC name is (3S)-4-[2-[1-(4-fluorophenyl)-3-propan-2-ylindol-2-yl]ethyl-methoxyphosphoryl]-3-hydroxybutanoic acid.
| Compound Name | (3S)-4-[2-[1-(4-fluorophenyl)-3-propan-2-ylindol-2-yl]ethyl-methoxyphosphoryl]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 54574705 |
| Molecular Formula | C24H29FNO5P |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | (3S)-4-[2-[1-(4-fluorophenyl)-3-propan-2-ylindol-2-yl]ethyl-methoxyphosphoryl]-3-hydroxybutanoic acid |
| SMILES | COP(=O)(CCc1c(C(C)C)c2ccccc2n1-c1ccc(F)cc1)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C24H29FNO5P/c1-16(2)24-20-6-4-5-7-21(20)26(18-10-8-17(25)9-11-18)22(24)12-13-32(30,31-3)15-19(27)14-23(28)29/h4-11,16,19,27H,12-15H2,1-3H3,(H,28,29)/t19-,32?/m0/s1 |
| InChIKey | ZZTBIKAYCCAULR-LSJBEEMESA-N |
| XLogP | 5.20 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|