C25H28FNO3 — CID 141380846
methyl 7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-5-hydroxyhept-2-enoate (PubChem CID 141380846) has the molecular formula C25H28FNO3 and a molecular weight of 409.50 g/mol. Its IUPAC name is methyl 7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-5-hydroxyhept-2-enoate.
| Compound Name | methyl 7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-5-hydroxyhept-2-enoate |
|---|---|
| PubChem CID | 141380846 |
| Molecular Formula | C25H28FNO3 |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | methyl 7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-5-hydroxyhept-2-enoate |
| SMILES | COC(=O)C=CCC(O)CCc1c(-c2ccc(F)cc2)c2ccccc2n1C(C)C |
| InChI | InChI=1S/C25H28FNO3/c1-17(2)27-22-9-5-4-8-21(22)25(18-11-13-19(26)14-12-18)23(27)16-15-20(28)7-6-10-24(29)30-3/h4-6,8-14,17,20,28H,7,15-16H2,1-3H3 |
| InChIKey | GLPRGYCJOSTCEH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|