C24H26FNO4 — CID 23110628
[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl] 3,5-dihydroxyhept-6-enoate (PubChem CID 23110628) has the molecular formula C24H26FNO4 and a molecular weight of 411.47 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl] 3,5-dihydroxyhept-6-enoate.
| Compound Name | [3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl] 3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 23110628 |
| Molecular Formula | C24H26FNO4 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl] 3,5-dihydroxyhept-6-enoate |
| SMILES | C=CC(O)CC(O)CC(=O)Oc1c(-c2ccc(F)cc2)c2ccccc2n1C(C)C |
| InChI | InChI=1S/C24H26FNO4/c1-4-18(27)13-19(28)14-22(29)30-24-23(16-9-11-17(25)12-10-16)20-7-5-6-8-21(20)26(24)15(2)3/h4-12,15,18-19,27-28H,1,13-14H2,2-3H3 |
| InChIKey | WUMOMFPBJGGOMK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|