C28H32FNO3 — CID 90689749
tert-butyl 7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3-oxohept-6-enoate (PubChem CID 90689749) has the molecular formula C28H32FNO3 and a molecular weight of 449.57 g/mol. Its IUPAC name is tert-butyl 7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3-oxohept-6-enoate.
| Compound Name | tert-butyl 7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3-oxohept-6-enoate |
|---|---|
| PubChem CID | 90689749 |
| Molecular Formula | C28H32FNO3 |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | tert-butyl 7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3-oxohept-6-enoate |
| SMILES | CC(C)n1c(C=CCCC(=O)CC(=O)OC(C)(C)C)c(-c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C28H32FNO3/c1-19(2)30-24-12-9-7-11-23(24)27(20-14-16-21(29)17-15-20)25(30)13-8-6-10-22(31)18-26(32)33-28(3,4)5/h7-9,11-17,19H,6,10,18H2,1-5H3 |
| InChIKey | HCPPCKWHWOZGSS-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|