C25H37NO5Si — CID 57034680
(3R)-7-[(2S,3R)-1-benzyl-3-methyl-5-oxopyrrolidin-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxohept-6-enoic acid (PubChem CID 57034680) has the molecular formula C25H37NO5Si and a molecular weight of 459.66 g/mol. Its IUPAC name is (3R)-7-[(2S,3R)-1-benzyl-3-methyl-5-oxopyrrolidin-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxohept-6-enoic acid.
| Compound Name | (3R)-7-[(2S,3R)-1-benzyl-3-methyl-5-oxopyrrolidin-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxohept-6-enoic acid |
|---|---|
| PubChem CID | 57034680 |
| Molecular Formula | C25H37NO5Si |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | (3R)-7-[(2S,3R)-1-benzyl-3-methyl-5-oxopyrrolidin-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxohept-6-enoic acid |
| SMILES | C[C@@H]1CC(=O)N(Cc2ccccc2)[C@@H]1C=CC(=O)C[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H37NO5Si/c1-18-14-23(28)26(17-19-10-8-7-9-11-19)22(18)13-12-20(27)15-21(16-24(29)30)31-32(5,6)25(2,3)4/h7-13,18,21-22H,14-17H2,1-6H3,(H,29,30)/t18-,21-,22-/m1/s1 |
| InChIKey | IMTBAFDPDNMCOM-STZQEDGTSA-N |
| XLogP | 4.80 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|