C27H41NO6SSi — CID 67915670
(4S)-2-benzyl-4-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-3,7-dioxohept-1-enyl]-5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid (PubChem CID 67915670) has the molecular formula C27H41NO6SSi and a molecular weight of 535.78 g/mol. Its IUPAC name is (4S)-2-benzyl-4-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-3,7-dioxohept-1-enyl]-5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid.
| Compound Name | (4S)-2-benzyl-4-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-3,7-dioxohept-1-enyl]-5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 67915670 |
| Molecular Formula | C27H41NO6SSi |
| Molecular Weight | 535.78 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | (4S)-2-benzyl-4-[(E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-3,7-dioxohept-1-enyl]-5,5-dimethyl-1,3-thiazolidine-3-carboxylic acid |
| SMILES | COC(=O)C[C@@H](CC(=O)/C=C/[C@@H]1N(C(=O)O)C(Cc2ccccc2)SC1(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H41NO6SSi/c1-26(2,3)36(7,8)34-21(18-24(30)33-6)17-20(29)14-15-22-27(4,5)35-23(28(22)25(31)32)16-19-12-10-9-11-13-19/h9-15,21-23H,16-18H2,1-8H3,(H,31,32)/b15-14+/t21-,22+,23?/m1/s1 |
| InChIKey | NVPLGLRWSWQAIZ-LTBXWUGTSA-N |
| XLogP | 5.90 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.78 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|