C27H38FNO5Si — CID 57302746
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[(1S)-2-(4-fluorophenyl)-3-oxo-2-azaspiro[4.4]nonan-1-yl]-5-oxohept-6-enoic acid (PubChem CID 57302746) has the molecular formula C27H38FNO5Si and a molecular weight of 503.69 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[(1S)-2-(4-fluorophenyl)-3-oxo-2-azaspiro[4.4]nonan-1-yl]-5-oxohept-6-enoic acid.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[(1S)-2-(4-fluorophenyl)-3-oxo-2-azaspiro[4.4]nonan-1-yl]-5-oxohept-6-enoic acid |
|---|---|
| PubChem CID | 57302746 |
| Molecular Formula | C27H38FNO5Si |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-7-[(1S)-2-(4-fluorophenyl)-3-oxo-2-azaspiro[4.4]nonan-1-yl]-5-oxohept-6-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CC(=O)O)CC(=O)C=C[C@@H]1N(c2ccc(F)cc2)C(=O)CC12CCCC2 |
| InChI | InChI=1S/C27H38FNO5Si/c1-26(2,3)35(4,5)34-22(17-25(32)33)16-21(30)12-13-23-27(14-6-7-15-27)18-24(31)29(23)20-10-8-19(28)9-11-20/h8-13,22-23H,6-7,14-18H2,1-5H3,(H,32,33)/t22-,23+/m1/s1 |
| InChIKey | CKLUBXPHCBCGDP-PKTZIBPZSA-N |
| XLogP | 5.87 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|