C36H40FNO3Si — CID 69187752
3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-4-[4-(3-hydroxyphenyl)phenyl]-1-phenylazetidin-2-one (PubChem CID 69187752) has the molecular formula C36H40FNO3Si and a molecular weight of 581.80 g/mol. Its IUPAC name is 3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-4-[4-(3-hydroxyphenyl)phenyl]-1-phenylazetidin-2-one.
| Compound Name | 3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-4-[4-(3-hydroxyphenyl)phenyl]-1-phenylazetidin-2-one |
|---|---|
| PubChem CID | 69187752 |
| Molecular Formula | C36H40FNO3Si |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-4-[4-(3-hydroxyphenyl)phenyl]-1-phenylazetidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCC1C(=O)N(c2ccccc2)C1c1ccc(-c2cccc(O)c2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C36H40FNO3Si/c1-36(2,3)42(4,5)41-33(26-18-20-29(37)21-19-26)23-22-32-34(38(35(32)40)30-11-7-6-8-12-30)27-16-14-25(15-17-27)28-10-9-13-31(39)24-28/h6-21,24,32-34,39H,22-23H2,1-5H3 |
| InChIKey | OWHPVSIWLRHRIA-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|