C36H49BrF2N2O3Si — CID 22252104
3-[4-[3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-1-(4-fluorophenyl)-4-oxoazetidin-2-yl]phenoxy]propyl-trimethylazanium bromide (PubChem CID 22252104) has the molecular formula C36H49BrF2N2O3Si and a molecular weight of 703.78 g/mol. Its IUPAC name is 3-[4-[3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-1-(4-fluorophenyl)-4-oxoazetidin-2-yl]phenoxy]propyl-trimethylazanium bromide.
| Compound Name | 3-[4-[3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-1-(4-fluorophenyl)-4-oxoazetidin-2-yl]phenoxy]propyl-trimethylazanium bromide |
|---|---|
| PubChem CID | 22252104 |
| Molecular Formula | C36H49BrF2N2O3Si |
| Molecular Weight | 703.78 g/mol |
| Exact Mass | 702.27 |
| IUPAC Name | 3-[4-[3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-1-(4-fluorophenyl)-4-oxoazetidin-2-yl]phenoxy]propyl-trimethylazanium bromide |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCC1C(=O)N(c2ccc(F)cc2)C1c1ccc(OCCC[N+](C)(C)C)cc1)c1ccc(F)cc1.[Br-] |
| InChI | InChI=1S/C36H49F2N2O3Si.BrH/c1-36(2,3)44(7,8)43-33(26-10-14-28(37)15-11-26)23-22-32-34(39(35(32)41)30-18-16-29(38)17-19-30)27-12-20-31(21-13-27)42-25-9-24-40(4,5)6;/h10-21,32-34H,9,22-25H2,1-8H3;1H/q+1;/p-1 |
| InChIKey | LUCIFJDOVDYYBW-UHFFFAOYSA-M |
| XLogP | 5.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.78 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|