C48H55F2NO5Si — CID 69256107
3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-1-(4-fluorophenyl)-4-[2-phenylmethoxy-4-(4-phenylmethoxybutoxy)phenyl]azetidin-2-one (PubChem CID 69256107) has the molecular formula C48H55F2NO5Si and a molecular weight of 792.05 g/mol. Its IUPAC name is 3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-1-(4-fluorophenyl)-4-[2-phenylmethoxy-4-(4-phenylmethoxybutoxy)phenyl]azetidin-2-one.
| Compound Name | 3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-1-(4-fluorophenyl)-4-[2-phenylmethoxy-4-(4-phenylmethoxybutoxy)phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 69256107 |
| Molecular Formula | C48H55F2NO5Si |
| Molecular Weight | 792.05 g/mol |
| Exact Mass | 791.38 |
| IUPAC Name | 3-[3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-1-(4-fluorophenyl)-4-[2-phenylmethoxy-4-(4-phenylmethoxybutoxy)phenyl]azetidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCC1C(=O)N(c2ccc(F)cc2)C1c1ccc(OCCCCOCc2ccccc2)cc1OCc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C48H55F2NO5Si/c1-48(2,3)57(4,5)56-44(37-18-20-38(49)21-19-37)29-28-43-46(51(47(43)52)40-24-22-39(50)23-25-40)42-27-26-41(32-45(42)55-34-36-16-10-7-11-17-36)54-31-13-12-30-53-33-35-14-8-6-9-15-35/h6-11,14-27,32,43-44,46H,12-13,28-31,33-34H2,1-5H3 |
| InChIKey | IQQPVEUWHMECTQ-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.05 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|