C32H37BrFNO4Si — CID 59643928
[5-bromo-2-[(2S,3R)-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-4-oxo-1-phenylazetidin-2-yl]phenyl] acetate (PubChem CID 59643928) has the molecular formula C32H37BrFNO4Si and a molecular weight of 626.64 g/mol. Its IUPAC name is [5-bromo-2-[(2S,3R)-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-4-oxo-1-phenylazetidin-2-yl]phenyl] acetate.
| Compound Name | [5-bromo-2-[(2S,3R)-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-4-oxo-1-phenylazetidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 59643928 |
| Molecular Formula | C32H37BrFNO4Si |
| Molecular Weight | 626.64 g/mol |
| Exact Mass | 625.17 |
| IUPAC Name | [5-bromo-2-[(2S,3R)-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-fluorophenyl)propyl]-4-oxo-1-phenylazetidin-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(Br)ccc1[C@@H]1[C@@H](CC[C@H](O[Si](C)(C)C(C)(C)C)c2ccc(F)cc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C32H37BrFNO4Si/c1-21(36)38-29-20-23(33)14-17-26(29)30-27(31(37)35(30)25-10-8-7-9-11-25)18-19-28(22-12-15-24(34)16-13-22)39-40(5,6)32(2,3)4/h7-17,20,27-28,30H,18-19H2,1-6H3/t27-,28+,30-/m1/s1 |
| InChIKey | KGAYURHRVHZODI-OYKXOOMRSA-N |
| XLogP | 8.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.64 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|